PMK ethyl glycidate cas 28578-16-7
- Състояние: ново
- Доставката се поема от: продавача
| CAS: | 5449-12-7 |
| MF: | C10H11NaO3 |
| MW: | 202.18 |
| EINECS: | 226-500-0 |
| Product Categories: | 5449-12-7;5449;BMK |
| Mol File: | 5449-12-7.mol |
| PMK ethyl glycidate Chemical Properties |
| Boiling point | 327.8±42.0 °C(Predicted) |
| density | 1.302±0.06 g/cm3(Predicted) |
| solubility | DMF: 15 mg/ml; DMSO: 30 mg/ml; Ethanol: 10 mg/ml; PBS (pH 7.2): 1 mg/ml |
| InChI | InChI=1S/C13H14O5/c1-3-15-12(14)13(2)11(18-13)8-4-5-9-10(6-8)17-7-16-9/h4-6,11H,3,7H2,1-2H3 |
| InChIKey | BRILFEZHPXQINW-UHFFFAOYSA-N |
| SMILES | O1C(C2=CC=C3OCOC3=C2)C1(C)C(OCC)=O |
| PMK ethyl glycidate Usage And Synthesis |
| Description | PMK ethyl glycidate is an analytical reference standard categorized as a precursor in the synthesis of methylenedioxy phenethylamines and amphetamines, including 3,4-MDMA. This product is intended for research and forensic applications. |
| Uses | NSC 195099 can be used as an analytical reference standard. |
| Application | PMK methyl glycidate is applied as immediate precursors of 3,4-methylenedioxymethamphetamine. |
КОМЕНТАР
Остави оценка: